Type | Name | Description | Pathways |
---|---|---|---|
KEGG reaction
|
R04640 | N-(5'-phospho-D-ribosylformimino)-5-amino-1- (5''-phospho-D-ribosyl)-4-imidazolecarboxamide ketol-isomerase; 1-(5-phospho-beta-D-ribosyl)-5-[(5-phospho-beta-D-ribosylamino)methylideneamino]imidazole-4-carboxamide aldose-ketose-isomerase; 5-(5-Phospho-D-ribosylaminoformimino)-1-(5-phosphoribosyl)-imidazole-4-carboxamide <=> N-(5'-Phospho-D-1'-ribulosylformimino)-5-amino-1-(5''-phospho-D-ribosyl)-4-imidazolecarboxamide | kornec00340kornec01100kornec01110kornec01230 |
KEGG reaction
|
R03509 | N-(5-Phospho-beta-D-ribosyl)anthranilate ketol-isomerase; N-(5-Phospho-D-ribosyl)anthranilate <=> 1-(2-Carboxyphenylamino)-1-deoxy-D-ribulose 5-phosphate | kornec00400kornec01100kornec01110kornec01230 |
Gene Code
|
priA | ||
Ortholog
|
N0.HOG0001602 | bifunctional 1-(5-phosphoribosyl)-5-((5-phosphoribosylamino)methylideneamino)imidazole-4-carboxamide isomerase/phosphoribosylanthranilate isomerase PriA | |
KEGG gene
|
K01817 | trpF; phosphoribosylanthranilate isomerase [EC:5.3.1.24] | kornec00400kornec01100kornec01110kornec01230 |
KEGG gene
|
K01814 | hisA; phosphoribosylformimino-5-aminoimidazole carboxamide ribotide isomerase [EC:5.3.1.16] | kornec00340kornec01100kornec01110kornec01230 |
Gene Ontology
|
GO:1901607 | alpha-amino acid biosynthetic process | |
Gene Ontology
|
GO:1901605 | alpha-amino acid metabolic process | |
Gene Ontology
|
GO:1901576 | organic substance biosynthetic process | |
Gene Ontology
|
GO:1901566 | organonitrogen compound biosynthetic process | |
Gene Ontology
|
GO:1901564 | organonitrogen compound metabolic process | |
Gene Ontology
|
GO:1901362 | organic cyclic compound biosynthetic process | |
Gene Ontology
|
GO:1901360 | organic cyclic compound metabolic process | |
Gene Ontology
|
GO:0071704 | organic substance metabolic process | |
Gene Ontology
|
GO:0052803 | imidazole-containing compound metabolic process | |
Gene Ontology
|
GO:0046483 | heterocycle metabolic process | |
Gene Ontology
|
GO:0046394 | carboxylic acid biosynthetic process | |
Gene Ontology
|
GO:0046219 | indolalkylamine biosynthetic process | |
Gene Ontology
|
GO:0044464 | obsolete cell part | |
Gene Ontology
|
GO:0044424 | obsolete intracellular part | |
Gene Ontology
|
GO:0044283 | small molecule biosynthetic process | |
Gene Ontology
|
GO:0044281 | small molecule metabolic process | |
Gene Ontology
|
GO:0044271 | cellular nitrogen compound biosynthetic process | |
Gene Ontology
|
GO:0044249 | cellular biosynthetic process | |
Gene Ontology
|
GO:0044238 | primary metabolic process | |
Gene Ontology
|
GO:0044237 | cellular metabolic process | |
Gene Ontology
|
GO:0044106 | cellular amine metabolic process | |
Gene Ontology
|
GO:0043436 | oxoacid metabolic process | |
Gene Ontology
|
GO:0042435 | indole-containing compound biosynthetic process | |
Gene Ontology
|
GO:0042430 | indole-containing compound metabolic process | |
Gene Ontology
|
GO:0042401 | cellular biogenic amine biosynthetic process | |
Gene Ontology
|
GO:0040007 | growth | |
Gene Ontology
|
GO:0034641 | cellular nitrogen compound metabolic process | |
Gene Ontology
|
GO:0019752 | carboxylic acid metabolic process | |
Gene Ontology
|
GO:0019438 | aromatic compound biosynthetic process | |
Gene Ontology
|
GO:0018130 | heterocycle biosynthetic process | |
Gene Ontology
|
GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses | |
Gene Ontology
|
GO:0016860 | intramolecular oxidoreductase activity | |
Gene Ontology
|
GO:0016853 | isomerase activity | |
Gene Ontology
|
GO:0016053 | organic acid biosynthetic process | |
Gene Ontology
|
GO:0009987 | cellular process | |
Gene Ontology
|
GO:0009309 | amine biosynthetic process | |
Gene Ontology
|
GO:0009308 | amine metabolic process | |
Gene Ontology
|
GO:0009073 | aromatic amino acid family biosynthetic process | |
Gene Ontology
|
GO:0009072 | aromatic amino acid family metabolic process | |
Gene Ontology
|
GO:0009058 | biosynthetic process | |
Gene Ontology
|
GO:0008652 | cellular amino acid biosynthetic process | |
Gene Ontology
|
GO:0008152 | metabolic process | |
Gene Ontology
|
GO:0008150 | biological_process | |
Gene Ontology
|
GO:0006807 | nitrogen compound metabolic process | |
Gene Ontology
|
GO:0006725 | cellular aromatic compound metabolic process | |
Gene Ontology
|
GO:0006586 | indolalkylamine metabolic process | |
Gene Ontology
|
GO:0006576 | cellular biogenic amine metabolic process | |
Gene Ontology
|
GO:0006568 | tryptophan metabolic process | |
Gene Ontology
|
GO:0006547 | histidine metabolic process | |
Gene Ontology
|
GO:0006520 | cellular amino acid metabolic process | |
Gene Ontology
|
GO:0006082 | organic acid metabolic process | |
Gene Ontology
|
GO:0005737 | cytoplasm | |
Gene Ontology
|
GO:0005623 | obsolete cell | |
Gene Ontology
|
GO:0005622 | intracellular anatomical structure | |
Gene Ontology
|
GO:0005575 | cellular_component | |
Gene Ontology
|
GO:0003949 | 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide isomerase activity | |
Gene Ontology
|
GO:0003824 | catalytic activity | |
Gene Ontology
|
GO:0003674 | molecular_function | |
Gene Ontology
|
GO:0000162 | tryptophan biosynthetic process | |
Gene Ontology
|
GO:0000105 | histidine biosynthetic process | |
Eggnog Protein
|
EP:hisA | ||
Eggnog Ortholog
|
EO:COG0106 | ||
Eggnog Description
|
ED:1-(5-phosphoribosyl)-5- (5-phosphoribosylamino)methylideneamino imidazole-4-carboxamide isomerase | ||
EC Number
|
EC:5.3.1.24 | phosphoribosylanthranilate isomerase; PRA isomerase; PRAI; IGPS:PRAI (indole-3-glycerol-phosphate synthetase/N-5'-phosphoribosylanthranilate isomerase complex); N-(5-phospho-beta-D-ribosyl)anthranilate ketol-isomerase | kornec00400kornec01100kornec01110 |
EC Number
|
EC:5.3.1.16 | 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide isomerase; N-(5'-phospho-D-ribosylformimino)-5-amino-1-(5''-phosphoribosyl)-4-imidazolecarboxamide isomerase; phosphoribosylformiminoaminophosphoribosylimidazolecarboxamide isomerase; N-(phosphoribosylformimino) aminophosphoribosylimidazolecarboxamide isomerase; 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide ketol-isomerase; 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide aldose-ketose-isomerase | kornec00340kornec01100kornec01110 |
Gene Product
|
bifunctional 1-(5-phosphoribosyl)-5-((5- phosphoribosylamino)methylideneamino)imidazole-4- carboxamide isomerase/phosphoribosylanthranilate isomerase PriA |
Pathway | Description |
---|---|
kornec00340 | Histidine metabolism |
kornec00400 | Phenylalanine, tyrosine and tryptophan biosynthesis |
kornec01100 | Metabolic pathways |
kornec01110 | Biosynthesis of secondary metabolites |
kornec01230 | Biosynthesis of amino acids |
Nucleotide sequence (GC-content: 71.0 %):
Protein sequence:
Located on scaffold FAM19038-p1-1_scf1